cas: 76666-32-5 — see every product listed under this CAS number, including other names
3'-Methoxyflavonol, 99.92% (CAS 76666-32-5) is a chemical reagent available from Chemat. Available pack sizes: 50 mg, 10mM/1mL, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-N6629-50 mg |
| cas | 76666-32-5 |
| size | 50 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 mg | 361.49 Pln | |
| MedChemExpress | 10mM/1mL | 384.71 Pln | |
| MedChemExpress | 100 mg | 505.45 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.92% |
3-hydroxy-2-(3-methoxyphenyl)chromen-4-one (CAS 76666-32-5) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 3-hydroxy-2-(3-methoxyphenyl)chromen-4-one. InChIKey: GYLGASXCHFNKHD-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 3-hydroxy-2-(3-methoxyphenyl)chromen-4-one |
| InChIKey | GYLGASXCHFNKHD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)