cas: 76666-32-5 — see every product listed under this CAS number, including other names
3-HYDROXY-3'-METHOXYFLAVONE, 98% (CAS 76666-32-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F852190-100MG |
| cas | 76666-32-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1216.26 Pln | |
| Fluorochem | 5g | 3501.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-hydroxy-2-(3-methoxyphenyl)chromen-4-one (CAS 76666-32-5) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 3-hydroxy-2-(3-methoxyphenyl)chromen-4-one. InChIKey: GYLGASXCHFNKHD-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 3-hydroxy-2-(3-methoxyphenyl)chromen-4-one |
| InChIKey | GYLGASXCHFNKHD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)