cas: 588-04-5 — see every product listed under this CAS number, including other names
3,3'-Azotoluene 98% (CAS 588-04-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A615909-100mg |
| cas | 588-04-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A615909 |
Bis(3-methylphenyl)diazene (CAS 588-04-5) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: bis(3-methylphenyl)diazene. InChIKey: HPSZIXYLILUGIP-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | bis(3-methylphenyl)diazene |
| InChIKey | HPSZIXYLILUGIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N=NC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)