cas: 588-04-5 — see every product listed under this CAS number, including other names
3,3'-DIMETHYLAZOBENZENE, 98% (CAS 588-04-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F827847-100MG |
| cas | 588-04-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 570.65 Pln | |
| Fluorochem | 5g | 1913.93 Pln | |
| Fluorochem | 25g | 8921.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Bis(3-methylphenyl)diazene (CAS 588-04-5) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: bis(3-methylphenyl)diazene. InChIKey: HPSZIXYLILUGIP-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | bis(3-methylphenyl)diazene |
| InChIKey | HPSZIXYLILUGIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N=NC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)