cas: 39070-63-8 — see every product listed under this CAS number, including other names
3,4-Diaminobenzophenone, 99% (CAS 39070-63-8) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 184800250 |
| cas | 39070-63-8 |
| size | 25g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 191.99 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
(3,4-diaminophenyl)-phenylmethanone (CAS 39070-63-8) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: (3,4-diaminophenyl)-phenylmethanone. InChIKey: RXCOGDYOZQGGMK-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | (3,4-diaminophenyl)-phenylmethanone |
| InChIKey | RXCOGDYOZQGGMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)