cas: 28036-91-1 — see every product listed under this CAS number, including other names
3,4-Dichlorobenzohydrazide, 97% (CAS 28036-91-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F061447-250MG |
| cas | 28036-91-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 825.77 Pln | |
| Fluorochem | 25g | 3101.01 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3,4-dichlorobenzohydrazide (CAS 28036-91-1) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 3,4-dichlorobenzohydrazide. InChIKey: VEDIADQJSGNNQE-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 3,4-dichlorobenzohydrazide |
| InChIKey | VEDIADQJSGNNQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NN)Cl)Cl |
Computed by PubChem (NCBI)