CAS 13142-57-9 is the registry number for 1-(3,5-Dichlorophenyl)urea, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3,5-dichlorophenyl)urea (CAS 13142-57-9) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: (3,5-dichlorophenyl)urea. InChIKey: FTJBMYITMFAUCP-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | (3,5-dichlorophenyl)urea |
| InChIKey | FTJBMYITMFAUCP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)NC(=O)N |
Computed by PubChem (NCBI)