cas: 959578-03-1 — see every product listed under this CAS number, including other names
3,4-Dichloropicolinic acid, >97%, >97% (CAS 959578-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144IG-100mg |
| cas | 959578-03-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 1g | 1062.80 Pln | |
| Chemat | 5g | 4989.20 Pln | |
| Chemat | 10g | 9179.60 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
3,4-dichloropyridine-2-carboxylic acid (CAS 959578-03-1) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 3,4-dichloropyridine-2-carboxylic acid. InChIKey: AFZMKBLOQNTBOT-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 3,4-dichloropyridine-2-carboxylic acid |
| InChIKey | AFZMKBLOQNTBOT-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)