cas: 959578-03-1 — see every product listed under this CAS number, including other names
3,4-Dichloropicolinic acid (CAS 959578-03-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | JNB57803-5g |
| cas | 959578-03-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 5g | price on request | |
| Biosynth | 0,5g | price on request | |
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 1g | 1731.70 Pln | |
| Fluorochem | 5g | 8234.62 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
3,4-dichloropyridine-2-carboxylic acid (CAS 959578-03-1) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 3,4-dichloropyridine-2-carboxylic acid. InChIKey: AFZMKBLOQNTBOT-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 3,4-dichloropyridine-2-carboxylic acid |
| InChIKey | AFZMKBLOQNTBOT-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)