cas: 887584-98-7 — see every product listed under this CAS number, including other names
3,4-Difluoro-5-methoxybenzoic acid, 97%, 97% (CAS 887584-98-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115C3J-100mg |
| cas | 887584-98-7 |
| size | 100mg |
| availability | 1.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 174.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,4-difluoro-5-methoxybenzoic acid (CAS 887584-98-7) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 3,4-difluoro-5-methoxybenzoic acid. InChIKey: ABWUPGYAHCQXHK-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 3,4-difluoro-5-methoxybenzoic acid |
| InChIKey | ABWUPGYAHCQXHK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)O)F)F |
Computed by PubChem (NCBI)