cas: 4430-47-1 — see every product listed under this CAS number, including other names
3,4-Methylenedioxybenzyl isothiocyanate (CAS 4430-47-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009529-5G |
| cas | 4430-47-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 1g | 133.30 Pln |
| delivery time | 3-4 weeks |
|---|
5-(isothiocyanatomethyl)-1,3-benzodioxole (CAS 4430-47-1) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 5-(isothiocyanatomethyl)-1,3-benzodioxole. InChIKey: PUJWRDBPAFJUJW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 5-(isothiocyanatomethyl)-1,3-benzodioxole |
| InChIKey | PUJWRDBPAFJUJW-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CN=C=S |
Computed by PubChem (NCBI)