cas: 618-56-4 — see every product listed under this CAS number, including other names
3,5–Diaminobenzoic acid dihydrochloride (CAS 618-56-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB54959-100g |
| cas | 618-56-4 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 1893.54 Pln | |
| GLPBio | 10g | 639.16 Pln | |
| GLPBio | 25g | 868.51 Pln | |
| GLPBio | 5g | 550.23 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3,5-diaminobenzoic acid;dihydrochloride (CAS 618-56-4) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 3,5-diaminobenzoic acid;dihydrochloride. InChIKey: IGPLRBRBTUNCRT-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 3,5-diaminobenzoic acid;dihydrochloride |
| InChIKey | IGPLRBRBTUNCRT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)N)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)