cas: 85068-33-3 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)phenylacetic acid 98% (CAS 85068-33-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A425568-5g |
| cas | 85068-33-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 170.12 Pln | |
| Ambeed | 25g | 314.75 Pln | |
| Ambeed | 100g | 843.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A425568 |
2-[3,5-bis(trifluoromethyl)phenyl]acetic acid (CAS 85068-33-3) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]acetic acid. InChIKey: PAWSKKHEEYTXSA-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]acetic acid |
| InChIKey | PAWSKKHEEYTXSA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)