cas: 85068-33-3 — see every product listed under this CAS number, including other names
2-[3,5-bis(trifluoromethyl)phenyl]acetic acid, 98%, 98% (CAS 85068-33-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IK8-1g |
| cas | 85068-33-3 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 100g | 947.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[3,5-bis(trifluoromethyl)phenyl]acetic acid (CAS 85068-33-3) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]acetic acid. InChIKey: PAWSKKHEEYTXSA-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]acetic acid |
| InChIKey | PAWSKKHEEYTXSA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)