cas: 85068-33-3 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)phenylacetic Acid, >97.0%(T) (CAS 85068-33-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1976-1G |
| cas | 85068-33-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 147.85 Pln | |
| TCI | 5g | 516.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(T) |
2-[3,5-bis(trifluoromethyl)phenyl]acetic acid (CAS 85068-33-3) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]acetic acid. InChIKey: PAWSKKHEEYTXSA-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]acetic acid |
| InChIKey | PAWSKKHEEYTXSA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)