cas: 177960-41-7 — see every product listed under this CAS number, including other names
3,5-Diamino-2-hydroxybenzoic acid hydrochloride 97% (CAS 177960-41-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A576715-100mg |
| cas | 177960-41-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 898.81 Pln | |
| Ambeed | 5g | 3535.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A576715 |
3,5-diamino-2-hydroxybenzoic acid;hydrochloride (CAS 177960-41-7) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: 3,5-diamino-2-hydroxybenzoic acid;hydrochloride. InChIKey: JGWMDXDSLNLAFI-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 3,5-diamino-2-hydroxybenzoic acid;hydrochloride |
| InChIKey | JGWMDXDSLNLAFI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)N)N.Cl |
Computed by PubChem (NCBI)