3,5-Diaminobenzoic acid dihydrochloride, 98%, 98%
cas: 618-56-4 — see every product listed under this CAS number, including other names
3,5-Diaminobenzoic acid dihydrochloride, 98%, 98% (CAS 618-56-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IKN-1g |
| cas | 618-56-4 |
| size | 1g |
| availability | 416g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 280.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-diaminobenzoic acid;dihydrochloride (CAS 618-56-4) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 3,5-diaminobenzoic acid;dihydrochloride. InChIKey: IGPLRBRBTUNCRT-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 3,5-diaminobenzoic acid;dihydrochloride |
| InChIKey | IGPLRBRBTUNCRT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)N)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
3,5-Diaminobenzoic acid dihydrochloride, 3,5-diaminobenzoic acid;dihydrochloride, 3,5-Diaminobenzoic acid dihydrochloride, 99%, 3,5-DiaminobenzoicAcidDihydrochloride, IGPLRBRBTUNCRT-UHFFFAOYSA-N, 35-Diaminobenzoic acid dihydrochloride, (3-azaniumyl-5-carboxy-phenyl)ammonium;dichloride, 3,5-Diaminobenzoic acid--hydrogen chloride (1/2)