cas: 924649-13-8 — see every product listed under this CAS number, including other names
3,5-Dibromo-4-(1,3-dioxolan-2-yl)pyridine, 95% (CAS 924649-13-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A688648-100g |
| cas | 924649-13-8 |
| size | 100g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100g | 8363.74 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 10g | 2132.60 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,5-dibromo-4-(1,3-dioxolan-2-yl)pyridine (CAS 924649-13-8) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: 3,5-dibromo-4-(1,3-dioxolan-2-yl)pyridine. InChIKey: GYEVGSDSVVWFRL-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | 3,5-dibromo-4-(1,3-dioxolan-2-yl)pyridine |
| InChIKey | GYEVGSDSVVWFRL-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=NC=C2Br)Br |
Computed by PubChem (NCBI)