cas: 3336-41-2 — see every product listed under this CAS number, including other names
3,5-Dichloro-4-hydroxybenzoic acid 98% (CAS 3336-41-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210726-5g |
| cas | 3336-41-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 553.94 Pln | |
| Ambeed | 500g | 1989.06 Pln | |
| Ambeed | 1000g | 3335.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A210726 |
3,5-dichloro-4-hydroxybenzoic acid is a derivative of p-salicylic acid with chloro- substituents at C-3 and C-5 of the benzene ring. It is a dichlorobenzene and a monohydroxybenzoic acid. It is functionally related to a benzoic acid and a 4-hydroxybenzoic acid. It is a conjugate acid of a 3,5-dichloro-4-hydroxybenzoate.
Source: ChEBI
| Molecular formula | C7H4Cl2O3 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 3,5-dichloro-4-hydroxybenzoic acid |
| InChIKey | AULKDLUOQCUNOK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)C(=O)O |
Computed by PubChem (NCBI)