Products 1804882-03-8
CAS 1804882-03-8 is the registry number for 2,3-Dichloro-5-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,3-dichloro-5-hydroxybenzoic acid (CAS 1804882-03-8) is a chemical compound with the molecular formula C7H4Cl2O3 and a molecular weight of 207.01 g/mol. IUPAC name: 2,3-dichloro-5-hydroxybenzoic acid. InChIKey: DEXDEXDDAQUGTG-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O3 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,3-dichloro-5-hydroxybenzoic acid |
| InChIKey | DEXDEXDDAQUGTG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)Cl)O |
Computed by PubChem (NCBI)