CAS 99725-34-5 appears in our catalog under these names: 2,4-Dichloro-6-hydroxybenzoic acid, 95+%, 2,4-Dichloro-6-hydroxybenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2,4-dichloro-6-hydroxybenzoic acid (CAS 99725-34-5) is a chemical compound with the molecular formula C7H4Cl2O3 and a molecular weight of 207.01 g/mol. IUPAC name: 2,4-dichloro-6-hydroxybenzoic acid. InChIKey: GHXWAANNBILSEF-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O3 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,4-dichloro-6-hydroxybenzoic acid |
| InChIKey | GHXWAANNBILSEF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)