CAS 50274-58-3 appears in our catalog under these names: 4,5-Dichloro-2-hydroxybenzoic acid, 4,5-Dichloro-2-hydroxybenzoic acid, 98%, 98%, 4,5-Dichloro-2-hydroxybenzoic acid, 98%, 4,5-Dichloro-2-hydroxybenzoic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
4,5-dichloro-2-hydroxybenzoic acid (CAS 50274-58-3) is a chemical compound with the molecular formula C7H4Cl2O3 and a molecular weight of 207.01 g/mol. IUPAC name: 4,5-dichloro-2-hydroxybenzoic acid. InChIKey: LMLXXZZOQAUVBB-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O3 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 4,5-dichloro-2-hydroxybenzoic acid |
| InChIKey | LMLXXZZOQAUVBB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)O)C(=O)O |
Computed by PubChem (NCBI)