CAS 14010-45-8 appears in our catalog under these names: 3,4-Dichloro-2-hydroxybenzoic acid, 97%, 3,4-Dichloro-2-hydroxybenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
3,4-dichloro-2-hydroxybenzoic acid (CAS 14010-45-8) is a chemical compound with the molecular formula C7H4Cl2O3 and a molecular weight of 207.01 g/mol. IUPAC name: 3,4-dichloro-2-hydroxybenzoic acid. InChIKey: YDOVRFJDZXIYMW-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O3 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 3,4-dichloro-2-hydroxybenzoic acid |
| InChIKey | YDOVRFJDZXIYMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)O)Cl)Cl |
Computed by PubChem (NCBI)