CAS 1173019-34-5 appears in our catalog under these names: 3,6-Dichloro-2-hydroxybenzoic-[13C6] Acid, 98% 98%atom%13C, 3,6-Dichlorosalicylic Acid (Dcsa) (Ring-13c6, 99%), 3,6-Dichloro-2-hydroxybenzoic acid-13C6, 99.0%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 1 mg.
2,5-dichloro-6-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 1173019-34-5) is a chemical compound with the molecular formula C7H4Cl2O3 and a molecular weight of 212.96 g/mol. IUPAC name: 2,5-dichloro-6-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: FKIKPQHMWFZFEB-IDEBNGHGSA-N.
| Molecular formula | C7H4Cl2O3 |
|---|---|
| Molecular weight | 212.96 g/mol |
| IUPAC name | 2,5-dichloro-6-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | FKIKPQHMWFZFEB-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13C](=[13C]1Cl)C(=O)O)O)Cl |
Computed by PubChem (NCBI)