3,5-Dichloro-4-nitropyridine 97%
cas: 433294-98-5 — see every product listed under this CAS number, including other names
3,5-Dichloro-4-nitropyridine 97% (CAS 433294-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A476225-100mg |
| cas | 433294-98-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1449.50 Pln | |
| Ambeed | 10g | 2623.19 Pln | |
| Ambeed | 25g | 5321.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A476225 |
3,5-dichloro-4-nitropyridine (CAS 433294-98-5) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,5-dichloro-4-nitropyridine. InChIKey: JGZHZSXAYXXCFB-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 3,5-dichloro-4-nitropyridine |
| InChIKey | JGZHZSXAYXXCFB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)