cas: 312736-49-5 — see every product listed under this CAS number, including other names
3,5-Dichloropyrazine-2-carboxylic acid 97% (CAS 312736-49-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210120-250mg |
| cas | 312736-49-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 464.94 Pln | |
| Ambeed | 25g | 1010.06 Pln | |
| Ambeed | 100g | 3813.56 Pln | |
| Ambeed | 500g | 15049.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A210120 |
3,5-dichloropyrazine-2-carboxylic acid (CAS 312736-49-5) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,5-dichloropyrazine-2-carboxylic acid. InChIKey: QRFOSHOPPFYNAH-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 3,5-dichloropyrazine-2-carboxylic acid |
| InChIKey | QRFOSHOPPFYNAH-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)