cas: 312736-49-5 — see every product listed under this CAS number, including other names
3,5-Dichloropyrazine-2-carboxylic acid, 95% (CAS 312736-49-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F075151-1G |
| cas | 312736-49-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 284.29 Pln | |
| Fluorochem | 10g | 450.90 Pln | |
| Fluorochem | 25g | 1002.79 Pln | |
| Fluorochem | 100g | 3819.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dichloropyrazine-2-carboxylic acid (CAS 312736-49-5) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,5-dichloropyrazine-2-carboxylic acid. InChIKey: QRFOSHOPPFYNAH-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 3,5-dichloropyrazine-2-carboxylic acid |
| InChIKey | QRFOSHOPPFYNAH-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)