cas: 151414-46-9 — see every product listed under this CAS number, including other names
3,5-Difluoro-2-nitrophenol 97% (CAS 151414-46-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148649-250mg |
| cas | 151414-46-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 426.00 Pln | |
| Ambeed | 10g | 776.44 Pln | |
| Ambeed | 25g | 1827.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148649 |
3,5-difluoro-2-nitrophenol (CAS 151414-46-9) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 3,5-difluoro-2-nitrophenol. InChIKey: LIQHPNDCQUCZKL-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 3,5-difluoro-2-nitrophenol |
| InChIKey | LIQHPNDCQUCZKL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)