3,5-Difluoro-2-nitrophenol, 97%
cas: 151414-46-9 — see every product listed under this CAS number, including other names
3,5-Difluoro-2-nitrophenol, 97% (CAS 151414-46-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223077-1G |
| cas | 151414-46-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 695.61 Pln | |
| Fluorochem | 25g | 1664.02 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3,5-difluoro-2-nitrophenol (CAS 151414-46-9) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 3,5-difluoro-2-nitrophenol. InChIKey: LIQHPNDCQUCZKL-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 3,5-difluoro-2-nitrophenol |
| InChIKey | LIQHPNDCQUCZKL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)