cas: 1621332-09-9 — see every product listed under this CAS number, including other names
3,5-Difluoro-4-methylphenylboronic acid 95% (CAS 1621332-09-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A897757-100mg |
| cas | 1621332-09-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 609.56 Pln | |
| Ambeed | 5g | 1588.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A897757 |
(3,5-difluoro-4-methylphenyl)boronic acid (CAS 1621332-09-9) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (3,5-difluoro-4-methylphenyl)boronic acid. InChIKey: PVWCCYIZIZXRFE-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2 |
|---|---|
| Molecular weight | 171.94 g/mol |
| IUPAC name | (3,5-difluoro-4-methylphenyl)boronic acid |
| InChIKey | PVWCCYIZIZXRFE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C)F)(O)O |
Computed by PubChem (NCBI)