cas: 18677-49-1 — see every product listed under this CAS number, including other names
3,5-Dimethoxy-2-nitropyridine, 95%, 95% (CAS 18677-49-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12OLGR-100mg |
| cas | 18677-49-1 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 693.20 Pln | |
| Chemat | 250mg | 1134.80 Pln | |
| Chemat | 1g | 2954.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,5-dimethoxy-2-nitropyridine (CAS 18677-49-1) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 3,5-dimethoxy-2-nitropyridine. InChIKey: PLDJLURDYKCZDJ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 3,5-dimethoxy-2-nitropyridine |
| InChIKey | PLDJLURDYKCZDJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(N=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)