Products 117860-56-7
CAS 117860-56-7 appears in our catalog under these names: 5-(Methoxycarbonyl)-1-methyl-1h-pyrazole-3-carboxylic acid, 97%, 5–(METHOXYCARBONYL)–1–METHYL–1H–PYRAZOLE–3–CARBOXYLIC ACID, 5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid, 5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid 95%, 5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 500mg.
5-methoxycarbonyl-1-methylpyrazole-3-carboxylic acid (CAS 117860-56-7) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 5-methoxycarbonyl-1-methylpyrazole-3-carboxylic acid. InChIKey: VMNNEPAQHIMLFM-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 5-methoxycarbonyl-1-methylpyrazole-3-carboxylic acid |
| InChIKey | VMNNEPAQHIMLFM-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)O)C(=O)OC |
Computed by PubChem (NCBI)