cas: 51149-08-7 — see every product listed under this CAS number, including other names
3,6-Dichloropyridazine-4-carboxylic acid, 96% (CAS 51149-08-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023599-1G |
| cas | 51149-08-7 |
| size | 1g |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 372.80 Pln | |
| Fluorochem | 100g | 1070.47 Pln | |
| Fluorochem | 500g | 4985.76 Pln | |
| Fluorochem | 1kg | 9723.68 Pln |
| purity | 96% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
3,6-dichloropyridazine-4-carboxylic acid (CAS 51149-08-7) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,6-dichloropyridazine-4-carboxylic acid. InChIKey: FRCXPDWDMAYSCE-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 3,6-dichloropyridazine-4-carboxylic acid |
| InChIKey | FRCXPDWDMAYSCE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)