cas: 51149-08-7 — see every product listed under this CAS number, including other names
3,6-Dichloropyridazine-4-carboxylic acid, 98%, 98% (CAS 51149-08-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144JZ-250mg |
| cas | 51149-08-7 |
| size | 250mg |
| availability | 59.35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 218.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,6-dichloropyridazine-4-carboxylic acid (CAS 51149-08-7) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,6-dichloropyridazine-4-carboxylic acid. InChIKey: FRCXPDWDMAYSCE-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 3,6-dichloropyridazine-4-carboxylic acid |
| InChIKey | FRCXPDWDMAYSCE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)