cas: 887267-03-0 — see every product listed under this CAS number, including other names
3,6-Difluoro-2-methoxybenzoic acid, 98% (CAS 887267-03-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A745702-100mg |
| cas | 887267-03-0 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 629.86 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,6-difluoro-2-methoxybenzoic acid (CAS 887267-03-0) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 3,6-difluoro-2-methoxybenzoic acid. InChIKey: LFXJCALGZMNDHA-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 3,6-difluoro-2-methoxybenzoic acid |
| InChIKey | LFXJCALGZMNDHA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1C(=O)O)F)F |
Computed by PubChem (NCBI)