cas: 1073182-87-2 — see every product listed under this CAS number, including other names
3–Amino–4,6–dichloropicolinic acid (CAS 1073182-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF31826-100mg |
| cas | 1073182-87-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 531.51 Pln | |
| GLPBio | 1g | 788.94 Pln | |
| GLPBio | 250mg | 611.08 Pln | |
| GLPBio | 5g | 1626.75 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-amino-4,6-dichloropyridine-2-carboxylic acid (CAS 1073182-87-2) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 3-amino-4,6-dichloropyridine-2-carboxylic acid. InChIKey: OVJPREKPWUUJQJ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 3-amino-4,6-dichloropyridine-2-carboxylic acid |
| InChIKey | OVJPREKPWUUJQJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)C(=O)O)N)Cl |
Computed by PubChem (NCBI)