cas: 1073182-87-2 — see every product listed under this CAS number, including other names
3-Amino-4,6-dichloropicolinic acid, 95% (CAS 1073182-87-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 100mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | HD-5458-250mg |
| cas | 1073182-87-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1424.52 Pln | |
| Fluorochem | 10g | 2793.83 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-amino-4,6-dichloropyridine-2-carboxylic acid (CAS 1073182-87-2) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 3-amino-4,6-dichloropyridine-2-carboxylic acid. InChIKey: OVJPREKPWUUJQJ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 3-amino-4,6-dichloropyridine-2-carboxylic acid |
| InChIKey | OVJPREKPWUUJQJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)C(=O)O)N)Cl |
Computed by PubChem (NCBI)