cas: 261762-96-3 — see every product listed under this CAS number, including other names
3–Chloro–2–fluorophenylacetic acid (CAS 261762-96-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD06808-100g |
| cas | 261762-96-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 2778.15 Pln | |
| GLPBio | 10g | 728.09 Pln | |
| GLPBio | 25g | 1093.17 Pln | |
| GLPBio | 5g | 601.72 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(3-chloro-2-fluorophenyl)acetic acid (CAS 261762-96-3) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-(3-chloro-2-fluorophenyl)acetic acid. InChIKey: LBGHWXGWKTZILK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-(3-chloro-2-fluorophenyl)acetic acid |
| InChIKey | LBGHWXGWKTZILK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)CC(=O)O |
Computed by PubChem (NCBI)