cas: 261762-96-3 — see every product listed under this CAS number, including other names
3-Chloro-2-fluorophenylacetic acid, 95% (CAS 261762-96-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009086-1G |
| cas | 261762-96-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 320.74 Pln | |
| Fluorochem | 100g | 1127.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(3-chloro-2-fluorophenyl)acetic acid (CAS 261762-96-3) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-(3-chloro-2-fluorophenyl)acetic acid. InChIKey: LBGHWXGWKTZILK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-(3-chloro-2-fluorophenyl)acetic acid |
| InChIKey | LBGHWXGWKTZILK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)CC(=O)O |
Computed by PubChem (NCBI)