cas: 172965-84-3 — see every product listed under this CAS number, including other names
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)propanoic acid, 97.39% (CAS 172965-84-3) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 10 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W067091-25 g |
| cas | 172965-84-3 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 951.28 Pln | |
| MedChemExpress | 10 g | 524.03 Pln | |
| MedChemExpress | 5 g | 347.56 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.39% |
3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid (CAS 172965-84-3) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid. InChIKey: QZUDWCRKKTVLLX-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid |
| InChIKey | QZUDWCRKKTVLLX-UHFFFAOYSA-N |
| SMILES | CN(CCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)