cas: 172965-84-3 — see every product listed under this CAS number, including other names
Fmoc-N-methyl-beta-alanine, 95% (CAS 172965-84-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300000-1G |
| cas | 172965-84-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 721.64 Pln | |
| Fluorochem | 100g | 2476.23 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid (CAS 172965-84-3) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid. InChIKey: QZUDWCRKKTVLLX-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid |
| InChIKey | QZUDWCRKKTVLLX-UHFFFAOYSA-N |
| SMILES | CN(CCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)