cas: 63024-23-7 — see every product listed under this CAS number, including other names
3-((1,1'-Biphenyl)-4-yl)-2-aminopropanoic acid hydrochloride, 98+% (CAS 63024-23-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A699504-1g |
| cas | 63024-23-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4132.24 Pln | |
| AmBeed | 5g | 12341.35 Pln | |
| AmBeed | 10g | 19365.64 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-3-(4-phenylphenyl)propanoic acid;hydrochloride (CAS 63024-23-7) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: 2-amino-3-(4-phenylphenyl)propanoic acid;hydrochloride. InChIKey: ZUZSOLFZHJQIAX-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | 2-amino-3-(4-phenylphenyl)propanoic acid;hydrochloride |
| InChIKey | ZUZSOLFZHJQIAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)