cas: 16364-36-6 — see every product listed under this CAS number, including other names
3-((2S,5S)-5-Methyl-3,6-dioxopiperazin-2-yl)propanoic acid, ≥98%, ≥98% (CAS 16364-36-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112UAT-10mg |
| cas | 16364-36-6 |
| size | 10mg |
| availability | 0.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 2003.60 Pln | |
| Chemat | 50mg | 5843.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
3-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]propanoic acid (CAS 16364-36-6) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: 3-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]propanoic acid. InChIKey: GWFWPFQFBPEFQN-WHFBIAKZSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 3-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]propanoic acid |
| InChIKey | GWFWPFQFBPEFQN-WHFBIAKZSA-N |
| SMILES | C[C@H]1C(=O)N[C@H](C(=O)N1)CCC(=O)O |
Computed by PubChem (NCBI)