cas: 16364-36-6 — see every product listed under this CAS number, including other names
Cyclo(Ala-Glu), 97% (CAS 16364-36-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A522758-1g |
| cas | 16364-36-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 22920.10 Pln | |
| AmBeed | 250mg | 8448.37 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]propanoic acid (CAS 16364-36-6) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: 3-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]propanoic acid. InChIKey: GWFWPFQFBPEFQN-WHFBIAKZSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 3-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]propanoic acid |
| InChIKey | GWFWPFQFBPEFQN-WHFBIAKZSA-N |
| SMILES | C[C@H]1C(=O)N[C@H](C(=O)N1)CCC(=O)O |
Computed by PubChem (NCBI)