3-((tert-Butoxycarbonyl)amino)-3-(thiophen-3-yl)propanoic acid, 95%
cas: 284492-23-5 — see every product listed under this CAS number, including other names
3-((tert-Butoxycarbonyl)amino)-3-(thiophen-3-yl)propanoic acid, 95% (CAS 284492-23-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g, 100g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A667417-250mg |
| cas | 284492-23-5 |
| size | 250mg |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 460.60 Pln | |
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1528.65 Pln | |
| Fluorochem | 10g | 2502.26 Pln | |
| Fluorochem | 25g | 4944.11 Pln | |
| Fluorochem | 100g | 13352.61 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid (CAS 284492-23-5) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid. InChIKey: ASXVJQPFJWSOQX-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid |
| InChIKey | ASXVJQPFJWSOQX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1=CSC=C1 |
Computed by PubChem (NCBI)
Synonyms:
3-((tert-Butoxycarbonyl)amino)-3-(thiophen-3-yl)propanoic acid, 3-[(tert-Butoxycarbonyl)amino]-3-(3-thienyl)-propanoic acid, 3-(Boc-amino)-3-(thiophen-3-yl)propanoic acid, 3-[(tert-butoxycarbonyl)amino]-3-(3-thienyl)propanoic acid, 3-(tert-butoxycarbonylamino)-3-(thiophen-3-yl)propanoic acid, 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid, 3-{[(tert-butoxy)carbonyl]amino}-3-(thiophen-3-yl)propanoic acid, Boc-(R)-3-amino-3-(3-thienyl)propionic acid, (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid, ASXVJQPFJWSOQX-UHFFFAOYSA-N