CAS 500788-99-8 appears in our catalog under these names: Boc-(r)-3-amino-3-(3-thienyl)-propionic acid, 95%, (R)-3-((tert-Butoxycarbonyl)amino)-3-(thiophen-3-yl)propanoic acid, 95%, 95%, Boc-(R)-3-amino-3-(3-thienyl)propionic acid, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid (CAS 500788-99-8) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid. InChIKey: ASXVJQPFJWSOQX-SECBINFHSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid |
| InChIKey | ASXVJQPFJWSOQX-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CSC=C1 |
Computed by PubChem (NCBI)