CAS 934570-44-2 is the registry number for 3-(1,3-Dioxolan-2-yl)-2-thiophenecarboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
3-(1,3-dioxolan-2-yl)thiophene-2-carboxylic acid (CAS 934570-44-2) is a chemical compound with the molecular formula C8H8O4S and a molecular weight of 200.21 g/mol. IUPAC name: 3-(1,3-dioxolan-2-yl)thiophene-2-carboxylic acid. InChIKey: ZODQJPSGAHBVHU-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 3-(1,3-dioxolan-2-yl)thiophene-2-carboxylic acid |
| InChIKey | ZODQJPSGAHBVHU-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(SC=C2)C(=O)O |
Computed by PubChem (NCBI)