cas: 1401425-69-1 — see every product listed under this CAS number, including other names
3-(1-Methyl-1H-imidazol-2-yl)aniline dihydrochloride, 97% (CAS 1401425-69-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A616689-100mg |
| cas | 1401425-69-1 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 770.88 Pln | |
| Ambeed | 1g | 1555.19 Pln | |
| Ambeed | 5g | 5348.81 Pln | |
| BLDpharm | 100mg | 508.73 Pln | |
| BLDpharm | 250mg | 825.29 Pln | |
| BLDpharm | 1g | 1674.99 Pln | |
| BLDpharm | 5g | 5762.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3-(1-methylimidazol-2-yl)aniline;dihydrochloride (CAS 1401425-69-1) is a chemical compound with the molecular formula C10H13Cl2N3 and a molecular weight of 246.13 g/mol. IUPAC name: 3-(1-methylimidazol-2-yl)aniline;dihydrochloride. InChIKey: PQZVXVXSEOZELR-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3 |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 3-(1-methylimidazol-2-yl)aniline;dihydrochloride |
| InChIKey | PQZVXVXSEOZELR-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1C2=CC(=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)