cas: 129053-84-5 — see every product listed under this CAS number, including other names
3-(1H-Pyrrole-2-carboxamido)propanoic acid (CAS 129053-84-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F435068-100MG |
| cas | 129053-84-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 627.92 Pln | |
| Fluorochem | 1g | 2059.71 Pln | |
| Fluorochem | 5g | 6495.65 Pln |
| delivery time | 3-4 weeks |
|---|
3-(1H-pyrrole-2-carbonylamino)propanoic acid (CAS 129053-84-5) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 3-(1H-pyrrole-2-carbonylamino)propanoic acid. InChIKey: WRPNGIQRAJOIRC-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 3-(1H-pyrrole-2-carbonylamino)propanoic acid |
| InChIKey | WRPNGIQRAJOIRC-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)