CAS 129053-84-5 appears in our catalog under these names: 3-[(1H-Pyrrole-2-carbonyl)-amino]propionic acid, 95%, 3–(1H–pyrrole–2–carboxamido)propanoic acid, 3-[(1H-Pyrrole-2-Carbonyl)-Amino]Propionic Acid, 95%+(LC-MS),RG, 95%+(LC-MS),RG, 3-(1H-Pyrrole-2-carboxamido)propanoic acid. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-(1H-pyrrole-2-carbonylamino)propanoic acid (CAS 129053-84-5) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 3-(1H-pyrrole-2-carbonylamino)propanoic acid. InChIKey: WRPNGIQRAJOIRC-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 3-(1H-pyrrole-2-carbonylamino)propanoic acid |
| InChIKey | WRPNGIQRAJOIRC-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)